C16H24O2 — CID 140936059
4-dec-1-enylbenzene-1,3-diol (PubChem CID 140936059) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-dec-1-enylbenzene-1,3-diol.
| Compound Name | 4-dec-1-enylbenzene-1,3-diol |
|---|---|
| PubChem CID | 140936059 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 4-dec-1-enylbenzene-1,3-diol |
| SMILES | CCCCCCCCC=Cc1ccc(O)cc1O |
| InChI | InChI=1S/C16H24O2/c1-2-3-4-5-6-7-8-9-10-14-11-12-15(17)13-16(14)18/h9-13,17-18H,2-8H2,1H3 |
| InChIKey | NGRHWGYTBMCROX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|