About acetylene;2-methyl-3-[(E)-non-1-enyl]phenol
acetylene;2-methyl-3-[(E)-non-1-enyl]phenol (PubChem CID 142088594) has the molecular formula C18H26O
and a molecular weight of 258.40 g/mol. Its IUPAC name is acetylene;2-methyl-3-[(E)-non-1-enyl]phenol.
Molecular Properties
| Compound Name | acetylene;2-methyl-3-[(E)-non-1-enyl]phenol |
| PubChem CID | 142088594 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | acetylene;2-methyl-3-[(E)-non-1-enyl]phenol |
| SMILES | C#C.CCCCCCC/C=C/c1cccc(O)c1C |
| InChI | InChI=1S/C16H24O.C2H2/c1-3-4-5-6-7-8-9-11-15-12-10-13-16(17)14(15)2;1-2/h9-13,17H,3-8H2,1-2H3;1-2H/b11-9+; |
| InChIKey | MUCSFMMEAMCPCU-LBEJWNQZSA-N |
| XLogP | 5.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;2-methyl-3-[(E)-non-1-enyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;2-methyl-3-[(E)-non-1-enyl]phenol?
The IUPAC name of acetylene;2-methyl-3-[(E)-non-1-enyl]phenol (CID 142088594) is acetylene;2-methyl-3-[(E)-non-1-enyl]phenol.
What is the SMILES notation for acetylene;2-methyl-3-[(E)-non-1-enyl]phenol?
The canonical SMILES for acetylene;2-methyl-3-[(E)-non-1-enyl]phenol is C#C.CCCCCCC/C=C/c1cccc(O)c1C.
What is the InChIKey of acetylene;2-methyl-3-[(E)-non-1-enyl]phenol?
The InChIKey is MUCSFMMEAMCPCU-LBEJWNQZSA-N. The full InChI is InChI=1S/C16H24O.C2H2/c1-3-4-5-6-7-8-9-11-15-12-10-13-16(17)14(15)2;1-2/h9-13,17H,3-8H2,1-2H3;1-2H/b11-9+;.
What are the key properties of acetylene;2-methyl-3-[(E)-non-1-enyl]phenol?
acetylene;2-methyl-3-[(E)-non-1-enyl]phenol has a molecular weight of 258.40 g/mol, XLogP of 5.32, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;2-methyl-3-[(E)-non-1-enyl]phenol is sourced from PubChem (CID 142088594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).