C17H26 — CID 173045984
1,2,3-trimethyl-4-oct-1-enylbenzene (PubChem CID 173045984) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is 1,2,3-trimethyl-4-oct-1-enylbenzene.
| Compound Name | 1,2,3-trimethyl-4-oct-1-enylbenzene |
|---|---|
| PubChem CID | 173045984 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 1,2,3-trimethyl-4-oct-1-enylbenzene |
| SMILES | CCCCCCC=Cc1ccc(C)c(C)c1C |
| InChI | InChI=1S/C17H26/c1-5-6-7-8-9-10-11-17-13-12-14(2)15(3)16(17)4/h10-13H,5-9H2,1-4H3 |
| InChIKey | MYQPKARESLZMHT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|