C17H26 — CID 173045818
3-hept-1-enyl-1,2,4,5-tetramethylbenzene (PubChem CID 173045818) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is 3-hept-1-enyl-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-hept-1-enyl-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 173045818 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 3-hept-1-enyl-1,2,4,5-tetramethylbenzene |
| SMILES | CCCCCC=Cc1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C17H26/c1-6-7-8-9-10-11-17-15(4)13(2)12-14(3)16(17)5/h10-12H,6-9H2,1-5H3 |
| InChIKey | DVHCQHCZYXHMEE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|