C13H17Br — CID 169476516
3-(3-bromoprop-1-enyl)-1,2,4,5-tetramethylbenzene (PubChem CID 169476516) has the molecular formula C13H17Br and a molecular weight of 253.18 g/mol. Its IUPAC name is 3-(3-bromoprop-1-enyl)-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-(3-bromoprop-1-enyl)-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 169476516 |
| Molecular Formula | C13H17Br |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 3-(3-bromoprop-1-enyl)-1,2,4,5-tetramethylbenzene |
| SMILES | Cc1cc(C)c(C)c(C=CCBr)c1C |
| InChI | InChI=1S/C13H17Br/c1-9-8-10(2)12(4)13(11(9)3)6-5-7-14/h5-6,8H,7H2,1-4H3 |
| InChIKey | FSPAWUIGXGJBQU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|