About 2-[(E)-hept-1-enyl]-1,3-dimethylbenzene
2-[(E)-hept-1-enyl]-1,3-dimethylbenzene (PubChem CID 102152874) has the molecular formula C15H22
and a molecular weight of 202.34 g/mol. Its IUPAC name is 2-[(E)-hept-1-enyl]-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 2-[(E)-hept-1-enyl]-1,3-dimethylbenzene |
| PubChem CID | 102152874 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 2-[(E)-hept-1-enyl]-1,3-dimethylbenzene |
| SMILES | CCCCC/C=C/c1c(C)cccc1C |
| InChI | InChI=1S/C15H22/c1-4-5-6-7-8-12-15-13(2)10-9-11-14(15)3/h8-12H,4-7H2,1-3H3/b12-8+ |
| InChIKey | JDUDPZXEQQHXHS-XYOKQWHBSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-hept-1-enyl]-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-hept-1-enyl]-1,3-dimethylbenzene?
The IUPAC name of 2-[(E)-hept-1-enyl]-1,3-dimethylbenzene (CID 102152874) is 2-[(E)-hept-1-enyl]-1,3-dimethylbenzene.
What is the SMILES notation for 2-[(E)-hept-1-enyl]-1,3-dimethylbenzene?
The canonical SMILES for 2-[(E)-hept-1-enyl]-1,3-dimethylbenzene is CCCCC/C=C/c1c(C)cccc1C.
What is the InChIKey of 2-[(E)-hept-1-enyl]-1,3-dimethylbenzene?
The InChIKey is JDUDPZXEQQHXHS-XYOKQWHBSA-N. The full InChI is InChI=1S/C15H22/c1-4-5-6-7-8-12-15-13(2)10-9-11-14(15)3/h8-12H,4-7H2,1-3H3/b12-8+.
What are the key properties of 2-[(E)-hept-1-enyl]-1,3-dimethylbenzene?
2-[(E)-hept-1-enyl]-1,3-dimethylbenzene has a molecular weight of 202.34 g/mol, XLogP of 4.90, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-hept-1-enyl]-1,3-dimethylbenzene is sourced from PubChem (CID 102152874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).