About 2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene
2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene (PubChem CID 102344241) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene |
| PubChem CID | 102344241 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene |
| SMILES | C=CCC/C=C/c1c(C)cccc1C |
| InChI | InChI=1S/C14H18/c1-4-5-6-7-11-14-12(2)9-8-10-13(14)3/h4,7-11H,1,5-6H2,2-3H3/b11-7+ |
| InChIKey | LMFOMPCOOOBTCO-YRNVUSSQSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene?
The IUPAC name of 2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene (CID 102344241) is 2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene.
What is the SMILES notation for 2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene?
The canonical SMILES for 2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene is C=CCC/C=C/c1c(C)cccc1C.
What is the InChIKey of 2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene?
The InChIKey is LMFOMPCOOOBTCO-YRNVUSSQSA-N. The full InChI is InChI=1S/C14H18/c1-4-5-6-7-11-14-12(2)9-8-10-13(14)3/h4,7-11H,1,5-6H2,2-3H3/b11-7+.
What are the key properties of 2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene?
2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene has a molecular weight of 186.30 g/mol, XLogP of 4.28, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E)-hexa-1,5-dienyl]-1,3-dimethylbenzene is sourced from PubChem (CID 102344241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).