C14H18 — CID 102344242
1-[(1E)-hexa-1,5-dienyl]-2,4-dimethylbenzene (PubChem CID 102344242) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-[(1E)-hexa-1,5-dienyl]-2,4-dimethylbenzene.
| Compound Name | 1-[(1E)-hexa-1,5-dienyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 102344242 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-[(1E)-hexa-1,5-dienyl]-2,4-dimethylbenzene |
| SMILES | C=CCC/C=C/c1ccc(C)cc1C |
| InChI | InChI=1S/C14H18/c1-4-5-6-7-8-14-10-9-12(2)11-13(14)3/h4,7-11H,1,5-6H2,2-3H3/b8-7+ |
| InChIKey | PNJBOXBUFOVFAV-BQYQJAHWSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|