About 6-(2,4-dimethylphenyl)hex-5-enyl acetate
6-(2,4-dimethylphenyl)hex-5-enyl acetate (PubChem CID 72594663) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is 6-(2,4-dimethylphenyl)hex-5-enyl acetate.
Molecular Properties
| Compound Name | 6-(2,4-dimethylphenyl)hex-5-enyl acetate |
| PubChem CID | 72594663 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 6-(2,4-dimethylphenyl)hex-5-enyl acetate |
| SMILES | CC(=O)OCCCCC=Cc1ccc(C)cc1C |
| InChI | InChI=1S/C16H22O2/c1-13-9-10-16(14(2)12-13)8-6-4-5-7-11-18-15(3)17/h6,8-10,12H,4-5,7,11H2,1-3H3 |
| InChIKey | QLGCRBZMPQHERS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,4-dimethylphenyl)hex-5-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-dimethylphenyl)hex-5-enyl acetate?
The IUPAC name of 6-(2,4-dimethylphenyl)hex-5-enyl acetate (CID 72594663) is 6-(2,4-dimethylphenyl)hex-5-enyl acetate.
What is the SMILES notation for 6-(2,4-dimethylphenyl)hex-5-enyl acetate?
The canonical SMILES for 6-(2,4-dimethylphenyl)hex-5-enyl acetate is CC(=O)OCCCCC=Cc1ccc(C)cc1C.
What is the InChIKey of 6-(2,4-dimethylphenyl)hex-5-enyl acetate?
The InChIKey is QLGCRBZMPQHERS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2/c1-13-9-10-16(14(2)12-13)8-6-4-5-7-11-18-15(3)17/h6,8-10,12H,4-5,7,11H2,1-3H3.
What are the key properties of 6-(2,4-dimethylphenyl)hex-5-enyl acetate?
6-(2,4-dimethylphenyl)hex-5-enyl acetate has a molecular weight of 246.35 g/mol, XLogP of 4.05, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-dimethylphenyl)hex-5-enyl acetate is sourced from PubChem (CID 72594663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).