C18H22O4 — CID 70287291
2-[(2,4-dimethylphenyl)methylidene]-5-(2-methylprop-2-enoyloxy)pentanoic acid (PubChem CID 70287291) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenyl)methylidene]-5-(2-methylprop-2-enoyloxy)pentanoic acid.
| Compound Name | 2-[(2,4-dimethylphenyl)methylidene]-5-(2-methylprop-2-enoyloxy)pentanoic acid |
|---|---|
| PubChem CID | 70287291 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-[(2,4-dimethylphenyl)methylidene]-5-(2-methylprop-2-enoyloxy)pentanoic acid |
| SMILES | C=C(C)C(=O)OCCCC(=Cc1ccc(C)cc1C)C(=O)O |
| InChI | InChI=1S/C18H22O4/c1-12(2)18(21)22-9-5-6-16(17(19)20)11-15-8-7-13(3)10-14(15)4/h7-8,10-11H,1,5-6,9H2,2-4H3,(H,19,20) |
| InChIKey | TYMJYFQEDYRXQW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|