C21H21N3O4 — CID 171768375
[2-(benzotriazol-2-yl)-4-methylphenyl] 4-(2-methylprop-2-enoyloxy)butanoate (PubChem CID 171768375) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is [2-(benzotriazol-2-yl)-4-methylphenyl] 4-(2-methylprop-2-enoyloxy)butanoate.
| Compound Name | [2-(benzotriazol-2-yl)-4-methylphenyl] 4-(2-methylprop-2-enoyloxy)butanoate |
|---|---|
| PubChem CID | 171768375 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [2-(benzotriazol-2-yl)-4-methylphenyl] 4-(2-methylprop-2-enoyloxy)butanoate |
| SMILES | C=C(C)C(=O)OCCCC(=O)Oc1ccc(C)cc1-n1nc2ccccc2n1 |
| InChI | InChI=1S/C21H21N3O4/c1-14(2)21(26)27-12-6-9-20(25)28-19-11-10-15(3)13-18(19)24-22-16-7-4-5-8-17(16)23-24/h4-5,7-8,10-11,13H,1,6,9,12H2,2-3H3 |
| InChIKey | KPSZBGOCBNJAAW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|