C23H25N3O4 — CID 171768286
[2-(benzotriazol-2-yl)-4-methylphenyl] 6-(2-methylprop-2-enoyloxy)hexanoate (PubChem CID 171768286) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is [2-(benzotriazol-2-yl)-4-methylphenyl] 6-(2-methylprop-2-enoyloxy)hexanoate.
| Compound Name | [2-(benzotriazol-2-yl)-4-methylphenyl] 6-(2-methylprop-2-enoyloxy)hexanoate |
|---|---|
| PubChem CID | 171768286 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [2-(benzotriazol-2-yl)-4-methylphenyl] 6-(2-methylprop-2-enoyloxy)hexanoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)Oc1ccc(C)cc1-n1nc2ccccc2n1 |
| InChI | InChI=1S/C23H25N3O4/c1-16(2)23(28)29-14-8-4-5-11-22(27)30-21-13-12-17(3)15-20(21)26-24-18-9-6-7-10-19(18)25-26/h6-7,9-10,12-13,15H,1,4-5,8,11,14H2,2-3H3 |
| InChIKey | HYJHJQDEZKMODT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|