About 1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate
1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate (PubChem CID 158120739) has the molecular formula C28H36O6
and a molecular weight of 468.59 g/mol. Its IUPAC name is 1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate.
Molecular Properties
| Compound Name | 1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate |
| PubChem CID | 158120739 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate |
| SMILES | C=C(C)C(=O)OCCCOC(=O)CCCCCCCCCC(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C28H36O6/c1-22(2)28(31)33-21-13-20-32-26(29)18-8-6-4-3-5-7-9-19-27(30)34-25-17-12-15-23-14-10-11-16-24(23)25/h10-12,14-17H,1,3-9,13,18-21H2,2H3 |
| InChIKey | BFSHQLOHRUJKOY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate?
The IUPAC name of 1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate (CID 158120739) is 1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate.
What is the SMILES notation for 1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate?
The canonical SMILES for 1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate is C=C(C)C(=O)OCCCOC(=O)CCCCCCCCCC(=O)Oc1cccc2ccccc12.
What is the InChIKey of 1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate?
The InChIKey is BFSHQLOHRUJKOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H36O6/c1-22(2)28(31)33-21-13-20-32-26(29)18-8-6-4-3-5-7-9-19-27(30)34-25-17-12-15-23-14-10-11-16-24(23)25/h10-12,14-17H,1,3-9,13,18-21H2,2H3.
What are the key properties of 1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate?
1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate has a molecular weight of 468.59 g/mol, XLogP of 6.31, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[3-(2-methylprop-2-enoyloxy)propyl] 11-O-naphthalen-1-yl undecanedioate is sourced from PubChem (CID 158120739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).