C28H29NO4 — CID 58800664
[4-(N-phenylanilino)phenyl] 6-(2-methylprop-2-enoyloxy)hexanoate (PubChem CID 58800664) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is [4-(N-phenylanilino)phenyl] 6-(2-methylprop-2-enoyloxy)hexanoate.
| Compound Name | [4-(N-phenylanilino)phenyl] 6-(2-methylprop-2-enoyloxy)hexanoate |
|---|---|
| PubChem CID | 58800664 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | [4-(N-phenylanilino)phenyl] 6-(2-methylprop-2-enoyloxy)hexanoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)Oc1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29NO4/c1-22(2)28(31)32-21-11-5-10-16-27(30)33-26-19-17-25(18-20-26)29(23-12-6-3-7-13-23)24-14-8-4-9-15-24/h3-4,6-9,12-15,17-20H,1,5,10-11,16,21H2,2H3 |
| InChIKey | HPKUVGZQCFTUOB-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|