C32H38O9 — CID 59739191
[4-[4-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]phenoxy]phenyl] 6-(2-methylprop-2-enoyloxy)hexanoate (PubChem CID 59739191) has the molecular formula C32H38O9 and a molecular weight of 566.65 g/mol. Its IUPAC name is [4-[4-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]phenoxy]phenyl] 6-(2-methylprop-2-enoyloxy)hexanoate.
| Compound Name | [4-[4-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]phenoxy]phenyl] 6-(2-methylprop-2-enoyloxy)hexanoate |
|---|---|
| PubChem CID | 59739191 |
| Molecular Formula | C32H38O9 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | [4-[4-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]phenoxy]phenyl] 6-(2-methylprop-2-enoyloxy)hexanoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)Oc1ccc(Oc2ccc(OC(=O)CCCCCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C32H38O9/c1-23(2)31(35)37-21-9-5-7-11-29(33)40-27-17-13-25(14-18-27)39-26-15-19-28(20-16-26)41-30(34)12-8-6-10-22-38-32(36)24(3)4/h13-20H,1,3,5-12,21-22H2,2,4H3 |
| InChIKey | BGOJQCVRDHEHMJ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|