C22H24O4 — CID 171768260
(4-phenylphenyl) 6-(2-methylprop-2-enoyloxy)hexanoate (PubChem CID 171768260) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is (4-phenylphenyl) 6-(2-methylprop-2-enoyloxy)hexanoate.
| Compound Name | (4-phenylphenyl) 6-(2-methylprop-2-enoyloxy)hexanoate |
|---|---|
| PubChem CID | 171768260 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (4-phenylphenyl) 6-(2-methylprop-2-enoyloxy)hexanoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24O4/c1-17(2)22(24)25-16-8-4-7-11-21(23)26-20-14-12-19(13-15-20)18-9-5-3-6-10-18/h3,5-6,9-10,12-15H,1,4,7-8,11,16H2,2H3 |
| InChIKey | CQWAVKGSJIEGPR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|