C24H23NO6 — CID 171768459
5-O-[4-(4-isocyanophenyl)phenyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] pentanedioate (PubChem CID 171768459) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is 5-O-[4-(4-isocyanophenyl)phenyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] pentanedioate.
| Compound Name | 5-O-[4-(4-isocyanophenyl)phenyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] pentanedioate |
|---|---|
| PubChem CID | 171768459 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 5-O-[4-(4-isocyanophenyl)phenyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] pentanedioate |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(OC(=O)CCCC(=O)OCCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C24H23NO6/c1-17(2)24(28)30-16-15-29-22(26)5-4-6-23(27)31-21-13-9-19(10-14-21)18-7-11-20(25-3)12-8-18/h7-14H,1,4-6,15-16H2,2H3 |
| InChIKey | DZWFWGBULFFEIL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 83.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|