C23H26O6 — CID 163508715
2-[4-[4-(2-propanoyloxyethoxy)phenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 163508715) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[4-[4-(2-propanoyloxyethoxy)phenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[4-(2-propanoyloxyethoxy)phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163508715 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-[4-[4-(2-propanoyloxyethoxy)phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2ccc(OCCOC(=O)CC)cc2)cc1 |
| InChI | InChI=1S/C23H26O6/c1-4-22(24)28-15-13-26-20-9-5-18(6-10-20)19-7-11-21(12-8-19)27-14-16-29-23(25)17(2)3/h5-12H,2,4,13-16H2,1,3H3 |
| InChIKey | DAVFODKQWDEFTG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|