C34H36O7 — CID 134527307
2-[3-[4-[4-(2-methylprop-2-enoxy)phenyl]phenyl]-5-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 134527307) has the molecular formula C34H36O7 and a molecular weight of 556.66 g/mol. Its IUPAC name is 2-[3-[4-[4-(2-methylprop-2-enoxy)phenyl]phenyl]-5-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-[4-[4-(2-methylprop-2-enoxy)phenyl]phenyl]-5-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134527307 |
| Molecular Formula | C34H36O7 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 2-[3-[4-[4-(2-methylprop-2-enoxy)phenyl]phenyl]-5-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)COc1ccc(-c2ccc(-c3cc(OCCOC(=O)C(=C)C)cc(OCCOC(=O)C(=C)C)c3)cc2)cc1 |
| InChI | InChI=1S/C34H36O7/c1-23(2)22-41-30-13-11-27(12-14-30)26-7-9-28(10-8-26)29-19-31(37-15-17-39-33(35)24(3)4)21-32(20-29)38-16-18-40-34(36)25(5)6/h7-14,19-21H,1,3,5,15-18,22H2,2,4,6H3 |
| InChIKey | JTJAEMSAVCRIOL-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|