C34H38O8 — CID 154932517
2-[4-[3-(1-hydroxy-2-methylprop-2-enoxy)-5-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenyl]phenoxy]ethyl 2-methylpropanoate (PubChem CID 154932517) has the molecular formula C34H38O8 and a molecular weight of 574.67 g/mol. Its IUPAC name is 2-[4-[3-(1-hydroxy-2-methylprop-2-enoxy)-5-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenyl]phenoxy]ethyl 2-methylpropanoate.
| Compound Name | 2-[4-[3-(1-hydroxy-2-methylprop-2-enoxy)-5-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenyl]phenoxy]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 154932517 |
| Molecular Formula | C34H38O8 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 2-[4-[3-(1-hydroxy-2-methylprop-2-enoxy)-5-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenyl]phenoxy]ethyl 2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2cc(OC(O)C(=C)C)cc(-c3ccc(OCCOC(=O)C(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C34H38O8/c1-22(2)32(35)40-17-15-38-29-11-7-25(8-12-29)27-19-28(21-31(20-27)42-34(37)24(5)6)26-9-13-30(14-10-26)39-16-18-41-33(36)23(3)4/h7-14,19-21,23,34,37H,1,5,15-18H2,2-4,6H3 |
| InChIKey | CHVOMXDPZWFCPK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|