C28H31FO8 — CID 130254216
2-[4-fluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethyl 2-methylpropanoate (PubChem CID 130254216) has the molecular formula C28H31FO8 and a molecular weight of 514.55 g/mol. Its IUPAC name is 2-[4-fluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethyl 2-methylpropanoate.
| Compound Name | 2-[4-fluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 130254216 |
| Molecular Formula | C28H31FO8 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 2-[4-fluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethyl 2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(F)c(-c2ccc(OC(=O)C(=C)C)cc2)cc1OCCOC(=O)C(C)C |
| InChI | InChI=1S/C28H31FO8/c1-17(2)26(30)35-13-11-33-24-15-22(20-7-9-21(10-8-20)37-28(32)19(5)6)23(29)16-25(24)34-12-14-36-27(31)18(3)4/h7-10,15-17H,3,5,11-14H2,1-2,4,6H3 |
| InChIKey | INYNUUXDERJXKE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|