C36H36O7 — CID 118975507
2-[4-[2-(2-methylprop-2-enoyloxy)-4-[(E)-3-[4-(2-methylprop-2-enoyloxy)phenyl]but-2-en-2-yl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 118975507) has the molecular formula C36H36O7 and a molecular weight of 580.68 g/mol. Its IUPAC name is 2-[4-[2-(2-methylprop-2-enoyloxy)-4-[(E)-3-[4-(2-methylprop-2-enoyloxy)phenyl]but-2-en-2-yl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[2-(2-methylprop-2-enoyloxy)-4-[(E)-3-[4-(2-methylprop-2-enoyloxy)phenyl]but-2-en-2-yl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118975507 |
| Molecular Formula | C36H36O7 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | 2-[4-[2-(2-methylprop-2-enoyloxy)-4-[(E)-3-[4-(2-methylprop-2-enoyloxy)phenyl]but-2-en-2-yl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2ccc(/C(C)=C(\C)c3ccc(OC(=O)C(=C)C)cc3)cc2OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C36H36O7/c1-22(2)34(37)41-20-19-40-30-14-11-28(12-15-30)32-18-13-29(21-33(32)43-36(39)24(5)6)26(8)25(7)27-9-16-31(17-10-27)42-35(38)23(3)4/h9-18,21H,1,3,5,19-20H2,2,4,6-8H3/b26-25+ |
| InChIKey | HNFGXRHBVIRSKE-OCEACIFDSA-N |
| XLogP | 7.77 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|