C38H36O6 — CID 118907602
2-[4-[2-(2-methylprop-1-enoxy)-4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 118907602) has the molecular formula C38H36O6 and a molecular weight of 588.70 g/mol. Its IUPAC name is 2-[4-[2-(2-methylprop-1-enoxy)-4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[2-(2-methylprop-1-enoxy)-4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118907602 |
| Molecular Formula | C38H36O6 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.25 |
| IUPAC Name | 2-[4-[2-(2-methylprop-1-enoxy)-4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2ccc(-c3ccc(-c4ccc(OC(=O)C(=C)C)cc4)cc3)cc2OC=C(C)C)cc1 |
| InChI | InChI=1S/C38H36O6/c1-25(2)24-43-36-23-32(15-20-35(36)31-13-16-33(17-14-31)41-21-22-42-37(39)26(3)4)30-9-7-28(8-10-30)29-11-18-34(19-12-29)44-38(40)27(5)6/h7-20,23-24H,3,5,21-22H2,1-2,4,6H3 |
| InChIKey | SIELMBGHOSFTOR-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|