C29H34O8 — CID 126565398
2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethyl 2,2-dimethylpropanoate (PubChem CID 126565398) has the molecular formula C29H34O8 and a molecular weight of 510.58 g/mol. Its IUPAC name is 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 126565398 |
| Molecular Formula | C29H34O8 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethyl 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(-c2ccc(OC(=O)C(=C)C)cc2)ccc1OCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C29H34O8/c1-19(2)26(30)35-16-14-34-25-18-22(21-8-11-23(12-9-21)37-27(31)20(3)4)10-13-24(25)33-15-17-36-28(32)29(5,6)7/h8-13,18H,1,3,14-17H2,2,4-7H3 |
| InChIKey | LRFYXKCABBHXPB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|