C30H32O7 — CID 138636794
[4-[3-methoxy-4-[2-[4-(2-methylprop-2-enoyloxy)phenoxy]ethoxy]phenyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 138636794) has the molecular formula C30H32O7 and a molecular weight of 504.58 g/mol. Its IUPAC name is [4-[3-methoxy-4-[2-[4-(2-methylprop-2-enoyloxy)phenoxy]ethoxy]phenyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[3-methoxy-4-[2-[4-(2-methylprop-2-enoyloxy)phenoxy]ethoxy]phenyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 138636794 |
| Molecular Formula | C30H32O7 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | [4-[3-methoxy-4-[2-[4-(2-methylprop-2-enoyloxy)phenoxy]ethoxy]phenyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc(OCCOc2ccc(-c3ccc(OC(=O)C(C)(C)C)cc3)cc2OC)cc1 |
| InChI | InChI=1S/C30H32O7/c1-20(2)28(31)36-24-14-12-23(13-15-24)34-17-18-35-26-16-9-22(19-27(26)33-6)21-7-10-25(11-8-21)37-29(32)30(3,4)5/h7-16,19H,1,17-18H2,2-6H3 |
| InChIKey | OIGNYTOYQHJNPD-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|