C27H25FO4 — CID 134268782
[3-fluoro-4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 134268782) has the molecular formula C27H25FO4 and a molecular weight of 432.49 g/mol. Its IUPAC name is [3-fluoro-4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [3-fluoro-4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134268782 |
| Molecular Formula | C27H25FO4 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [3-fluoro-4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(-c3ccc(OC(=O)C(C)(C)C)cc3F)cc2)cc1 |
| InChI | InChI=1S/C27H25FO4/c1-17(2)25(29)31-21-12-10-19(11-13-21)18-6-8-20(9-7-18)23-15-14-22(16-24(23)28)32-26(30)27(3,4)5/h6-16H,1H2,2-5H3 |
| InChIKey | XFGSDRCMJKXELU-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|