C37H34F2O5 — CID 155219909
[4-[2-fluoro-4-[2-[4-[2-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-2,6-dimethylphenyl]propan-2-yloxy]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 155219909) has the molecular formula C37H34F2O5 and a molecular weight of 596.67 g/mol. Its IUPAC name is [4-[2-fluoro-4-[2-[4-[2-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-2,6-dimethylphenyl]propan-2-yloxy]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-fluoro-4-[2-[4-[2-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-2,6-dimethylphenyl]propan-2-yloxy]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155219909 |
| Molecular Formula | C37H34F2O5 |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | [4-[2-fluoro-4-[2-[4-[2-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-2,6-dimethylphenyl]propan-2-yloxy]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC(C)(C)c3c(C)cc(-c4ccc(OC(=O)C(=C)C)cc4F)cc3C)cc2F)cc1 |
| InChI | InChI=1S/C37H34F2O5/c1-21(2)35(40)42-27-11-9-25(10-12-27)30-16-14-29(20-33(30)39)44-37(7,8)34-23(5)17-26(18-24(34)6)31-15-13-28(19-32(31)38)43-36(41)22(3)4/h9-20H,1,3H2,2,4-8H3 |
| InChIKey | YLDQUTWTLJVJNM-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|