C20H19FO3 — CID 146620506
[3-fluoro-4-[4-(2-methylprop-2-enoxy)phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 146620506) has the molecular formula C20H19FO3 and a molecular weight of 326.37 g/mol. Its IUPAC name is [3-fluoro-4-[4-(2-methylprop-2-enoxy)phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [3-fluoro-4-[4-(2-methylprop-2-enoxy)phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146620506 |
| Molecular Formula | C20H19FO3 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | [3-fluoro-4-[4-(2-methylprop-2-enoxy)phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)COc1ccc(-c2ccc(OC(=O)C(=C)C)cc2F)cc1 |
| InChI | InChI=1S/C20H19FO3/c1-13(2)12-23-16-7-5-15(6-8-16)18-10-9-17(11-19(18)21)24-20(22)14(3)4/h5-11H,1,3,12H2,2,4H3 |
| InChIKey | IAIVFDNFJVDUHG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|