C22H25FO4 — CID 118699959
[3-fluoro-4-[4-[5-hydroxy-4-(hydroxymethyl)pentyl]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 118699959) has the molecular formula C22H25FO4 and a molecular weight of 372.44 g/mol. Its IUPAC name is [3-fluoro-4-[4-[5-hydroxy-4-(hydroxymethyl)pentyl]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [3-fluoro-4-[4-[5-hydroxy-4-(hydroxymethyl)pentyl]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118699959 |
| Molecular Formula | C22H25FO4 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [3-fluoro-4-[4-[5-hydroxy-4-(hydroxymethyl)pentyl]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(CCCC(CO)CO)cc2)c(F)c1 |
| InChI | InChI=1S/C22H25FO4/c1-15(2)22(26)27-19-10-11-20(21(23)12-19)18-8-6-16(7-9-18)4-3-5-17(13-24)14-25/h6-12,17,24-25H,1,3-5,13-14H2,2H3 |
| InChIKey | PJIOXBWUDIUVNC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|