C22H25FO4 — CID 144983574
[3-fluoro-4-[4-[2-(1-hydroxy-2-methylpropoxy)ethyl]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 144983574) has the molecular formula C22H25FO4 and a molecular weight of 372.44 g/mol. Its IUPAC name is [3-fluoro-4-[4-[2-(1-hydroxy-2-methylpropoxy)ethyl]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [3-fluoro-4-[4-[2-(1-hydroxy-2-methylpropoxy)ethyl]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 144983574 |
| Molecular Formula | C22H25FO4 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [3-fluoro-4-[4-[2-(1-hydroxy-2-methylpropoxy)ethyl]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(CCOC(O)C(C)C)cc2)c(F)c1 |
| InChI | InChI=1S/C22H25FO4/c1-14(2)21(24)26-12-11-16-5-7-17(8-6-16)19-10-9-18(13-20(19)23)27-22(25)15(3)4/h5-10,13-14,21,24H,3,11-12H2,1-2,4H3 |
| InChIKey | VGWLBVRGFRWCLC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|