C28H33FO8 — CID 126552104
[4-[3,4-bis[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxy]phenyl]-3-fluorophenyl] 2-methylprop-2-enoate (PubChem CID 126552104) has the molecular formula C28H33FO8 and a molecular weight of 516.56 g/mol. Its IUPAC name is [4-[3,4-bis[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxy]phenyl]-3-fluorophenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[3,4-bis[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxy]phenyl]-3-fluorophenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126552104 |
| Molecular Formula | C28H33FO8 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | [4-[3,4-bis[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxy]phenyl]-3-fluorophenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OCCOC(O)C(=C)C)c(OCCOC(O)C(=C)C)c2)c(F)c1 |
| InChI | InChI=1S/C28H33FO8/c1-17(2)26(30)35-13-11-33-24-10-7-20(15-25(24)34-12-14-36-27(31)18(3)4)22-9-8-21(16-23(22)29)37-28(32)19(5)6/h7-10,15-16,26-27,30-31H,1,3,5,11-14H2,2,4,6H3 |
| InChIKey | OANHTUACQBBAQM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|