C34H24F2O4 — CID 154680109
[3-fluoro-4-[7-[2-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-9-methylidenefluoren-2-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 154680109) has the molecular formula C34H24F2O4 and a molecular weight of 534.56 g/mol. Its IUPAC name is [3-fluoro-4-[7-[2-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-9-methylidenefluoren-2-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [3-fluoro-4-[7-[2-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-9-methylidenefluoren-2-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154680109 |
| Molecular Formula | C34H24F2O4 |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | [3-fluoro-4-[7-[2-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-9-methylidenefluoren-2-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc3c(c2)C(=C)c2cc(-c4ccc(OC(=O)C(=C)C)cc4F)ccc2-3)c(F)c1 |
| InChI | InChI=1S/C34H24F2O4/c1-18(2)33(37)39-23-8-12-25(31(35)16-23)21-6-10-27-28-11-7-22(15-30(28)20(5)29(27)14-21)26-13-9-24(17-32(26)36)40-34(38)19(3)4/h6-17H,1,3,5H2,2,4H3 |
| InChIKey | IOBWQYVREHUQDV-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|