C23H21FO6 — CID 118181749
[3-[3-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]-3-oxopropyl] 2-methylprop-2-enoate (PubChem CID 118181749) has the molecular formula C23H21FO6 and a molecular weight of 412.41 g/mol. Its IUPAC name is [3-[3-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]-3-oxopropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[3-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]-3-oxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118181749 |
| Molecular Formula | C23H21FO6 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [3-[3-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]-3-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(=O)Oc1ccc(-c2ccc(OC(=O)C(=C)C)cc2)c(F)c1 |
| InChI | InChI=1S/C23H21FO6/c1-14(2)22(26)28-12-11-21(25)29-18-9-10-19(20(24)13-18)16-5-7-17(8-6-16)30-23(27)15(3)4/h5-10,13H,1,3,11-12H2,2,4H3 |
| InChIKey | DVASBKYYSZNCGK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|