C31H35FO4 — CID 135252213
[4-[2-[4-[2-ethyl-4-[4-hydroxy-3-(hydroxymethyl)butyl]phenyl]-3-fluorophenyl]ethyl]phenyl] 2-methylprop-2-enoate (PubChem CID 135252213) has the molecular formula C31H35FO4 and a molecular weight of 490.62 g/mol. Its IUPAC name is [4-[2-[4-[2-ethyl-4-[4-hydroxy-3-(hydroxymethyl)butyl]phenyl]-3-fluorophenyl]ethyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[4-[2-ethyl-4-[4-hydroxy-3-(hydroxymethyl)butyl]phenyl]-3-fluorophenyl]ethyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 135252213 |
| Molecular Formula | C31H35FO4 |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | [4-[2-[4-[2-ethyl-4-[4-hydroxy-3-(hydroxymethyl)butyl]phenyl]-3-fluorophenyl]ethyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(CCc2ccc(-c3ccc(CCC(CO)CO)cc3CC)c(F)c2)cc1 |
| InChI | InChI=1S/C31H35FO4/c1-4-26-17-23(7-8-25(19-33)20-34)11-15-28(26)29-16-12-24(18-30(29)32)6-5-22-9-13-27(14-10-22)36-31(35)21(2)3/h9-18,25,33-34H,2,4-8,19-20H2,1,3H3 |
| InChIKey | PEEIZPBHMXUXLA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|