C37H48O4 — CID 145006977
3-[4-[2-[4-[2-ethyl-4-[6-hydroxy-5-(hydroxymethyl)hexyl]phenyl]-3-methylphenyl]ethyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 145006977) has the molecular formula C37H48O4 and a molecular weight of 556.79 g/mol. Its IUPAC name is 3-[4-[2-[4-[2-ethyl-4-[6-hydroxy-5-(hydroxymethyl)hexyl]phenyl]-3-methylphenyl]ethyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-[2-[4-[2-ethyl-4-[6-hydroxy-5-(hydroxymethyl)hexyl]phenyl]-3-methylphenyl]ethyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145006977 |
| Molecular Formula | C37H48O4 |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 556.36 |
| IUPAC Name | 3-[4-[2-[4-[2-ethyl-4-[6-hydroxy-5-(hydroxymethyl)hexyl]phenyl]-3-methylphenyl]ethyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1ccc(CCc2ccc(-c3ccc(CCCCC(CO)CO)cc3CC)c(C)c2)cc1 |
| InChI | InChI=1S/C37H48O4/c1-5-34-24-31(9-6-7-10-33(25-38)26-39)19-21-36(34)35-20-18-32(23-28(35)4)17-16-30-14-12-29(13-15-30)11-8-22-41-37(40)27(2)3/h12-15,18-21,23-24,33,38-39H,2,5-11,16-17,22,25-26H2,1,3-4H3 |
| InChIKey | BUPYWQODHZNAIS-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|