C31H36O5 — CID 145122174
2-[2-[4-[4-[4-hydroxy-3-(hydroxymethyl)butyl]-2-methylphenyl]phenyl]-5-methylphenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 145122174) has the molecular formula C31H36O5 and a molecular weight of 488.62 g/mol. Its IUPAC name is 2-[2-[4-[4-[4-hydroxy-3-(hydroxymethyl)butyl]-2-methylphenyl]phenyl]-5-methylphenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[4-[4-[4-hydroxy-3-(hydroxymethyl)butyl]-2-methylphenyl]phenyl]-5-methylphenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145122174 |
| Molecular Formula | C31H36O5 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 2-[2-[4-[4-[4-hydroxy-3-(hydroxymethyl)butyl]-2-methylphenyl]phenyl]-5-methylphenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(C)ccc1-c1ccc(-c2ccc(CCC(CO)CO)cc2C)cc1 |
| InChI | InChI=1S/C31H36O5/c1-21(2)31(34)36-16-15-35-30-17-22(3)5-13-29(30)27-11-9-26(10-12-27)28-14-8-24(18-23(28)4)6-7-25(19-32)20-33/h5,8-14,17-18,25,32-33H,1,6-7,15-16,19-20H2,2-4H3 |
| InChIKey | VNFZZDGRBRFDIG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|