C29H32O4 — CID 145122789
[5-[4-hydroxy-3-(hydroxymethyl)butyl]-2-[2-methyl-4-(4-methylphenyl)phenyl]phenyl]methyl prop-2-enoate (PubChem CID 145122789) has the molecular formula C29H32O4 and a molecular weight of 444.57 g/mol. Its IUPAC name is [5-[4-hydroxy-3-(hydroxymethyl)butyl]-2-[2-methyl-4-(4-methylphenyl)phenyl]phenyl]methyl prop-2-enoate.
| Compound Name | [5-[4-hydroxy-3-(hydroxymethyl)butyl]-2-[2-methyl-4-(4-methylphenyl)phenyl]phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 145122789 |
| Molecular Formula | C29H32O4 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [5-[4-hydroxy-3-(hydroxymethyl)butyl]-2-[2-methyl-4-(4-methylphenyl)phenyl]phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1cc(CCC(CO)CO)ccc1-c1ccc(-c2ccc(C)cc2)cc1C |
| InChI | InChI=1S/C29H32O4/c1-4-29(32)33-19-26-16-22(7-8-23(17-30)18-31)9-13-28(26)27-14-12-25(15-21(27)3)24-10-5-20(2)6-11-24/h4-6,9-16,23,30-31H,1,7-8,17-19H2,2-3H3 |
| InChIKey | BXNKYMSOFXPJEA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|