C26H26O3 — CID 145122713
[5-[4-(hydroxymethyl)phenyl]-2-(4-methylphenyl)phenyl]methyl (E)-2-methylbut-2-enoate (PubChem CID 145122713) has the molecular formula C26H26O3 and a molecular weight of 386.49 g/mol. Its IUPAC name is [5-[4-(hydroxymethyl)phenyl]-2-(4-methylphenyl)phenyl]methyl (E)-2-methylbut-2-enoate.
| Compound Name | [5-[4-(hydroxymethyl)phenyl]-2-(4-methylphenyl)phenyl]methyl (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 145122713 |
| Molecular Formula | C26H26O3 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [5-[4-(hydroxymethyl)phenyl]-2-(4-methylphenyl)phenyl]methyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OCc1cc(-c2ccc(CO)cc2)ccc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C26H26O3/c1-4-19(3)26(28)29-17-24-15-23(21-11-7-20(16-27)8-12-21)13-14-25(24)22-9-5-18(2)6-10-22/h4-15,27H,16-17H2,1-3H3/b19-4+ |
| InChIKey | VSRNWPTUCZLATI-RMOCHZDMSA-N |
| XLogP | 5.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|