C36H38O3 — CID 134193871
[5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[4-(hydroxymethyl)phenyl]phenyl]methyl prop-2-enoate (PubChem CID 134193871) has the molecular formula C36H38O3 and a molecular weight of 518.70 g/mol. Its IUPAC name is [5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[4-(hydroxymethyl)phenyl]phenyl]methyl prop-2-enoate.
| Compound Name | [5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[4-(hydroxymethyl)phenyl]phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 134193871 |
| Molecular Formula | C36H38O3 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | [5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[4-(hydroxymethyl)phenyl]phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1cc(-c2ccc(-c3ccc(CCCCC)cc3)cc2CC)ccc1-c1ccc(CO)cc1 |
| InChI | InChI=1S/C36H38O3/c1-4-7-8-9-26-10-14-29(15-11-26)31-18-20-34(28(5-2)22-31)32-19-21-35(30-16-12-27(24-37)13-17-30)33(23-32)25-39-36(38)6-3/h6,10-23,37H,3-5,7-9,24-25H2,1-2H3 |
| InChIKey | AHKAFQVXJVCYRP-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|