C25H24O3 — CID 134200547
[2-[2-[4-(hydroxymethyl)phenyl]ethyl]-5-phenylphenyl]methyl prop-2-enoate (PubChem CID 134200547) has the molecular formula C25H24O3 and a molecular weight of 372.46 g/mol. Its IUPAC name is [2-[2-[4-(hydroxymethyl)phenyl]ethyl]-5-phenylphenyl]methyl prop-2-enoate.
| Compound Name | [2-[2-[4-(hydroxymethyl)phenyl]ethyl]-5-phenylphenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 134200547 |
| Molecular Formula | C25H24O3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [2-[2-[4-(hydroxymethyl)phenyl]ethyl]-5-phenylphenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1cc(-c2ccccc2)ccc1CCc1ccc(CO)cc1 |
| InChI | InChI=1S/C25H24O3/c1-2-25(27)28-18-24-16-23(21-6-4-3-5-7-21)15-14-22(24)13-12-19-8-10-20(17-26)11-9-19/h2-11,14-16,26H,1,12-13,17-18H2 |
| InChIKey | ASXGMEIXNMENNI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|