C37H33NO2 — CID 59399913
2-[4-[2-[4-(N-(4-phenylphenyl)anilino)phenyl]ethyl]phenyl]ethyl prop-2-enoate (PubChem CID 59399913) has the molecular formula C37H33NO2 and a molecular weight of 523.68 g/mol. Its IUPAC name is 2-[4-[2-[4-(N-(4-phenylphenyl)anilino)phenyl]ethyl]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-[2-[4-(N-(4-phenylphenyl)anilino)phenyl]ethyl]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 59399913 |
| Molecular Formula | C37H33NO2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | 2-[4-[2-[4-(N-(4-phenylphenyl)anilino)phenyl]ethyl]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(CCc2ccc(N(c3ccccc3)c3ccc(-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H33NO2/c1-2-37(39)40-28-27-31-17-15-29(16-18-31)13-14-30-19-23-35(24-20-30)38(34-11-7-4-8-12-34)36-25-21-33(22-26-36)32-9-5-3-6-10-32/h2-12,15-26H,1,13-14,27-28H2 |
| InChIKey | UHUGENCSJCSUJC-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|