C40H43NO4 — CID 58876614
3-[3-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethyl]-5-(3-prop-2-enoyloxypropyl)phenyl]propyl prop-2-enoate (PubChem CID 58876614) has the molecular formula C40H43NO4 and a molecular weight of 601.79 g/mol. Its IUPAC name is 3-[3-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethyl]-5-(3-prop-2-enoyloxypropyl)phenyl]propyl prop-2-enoate.
| Compound Name | 3-[3-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethyl]-5-(3-prop-2-enoyloxypropyl)phenyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 58876614 |
| Molecular Formula | C40H43NO4 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | 3-[3-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethyl]-5-(3-prop-2-enoyloxypropyl)phenyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1cc(CCCOC(=O)C=C)cc(CCc2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c1 |
| InChI | InChI=1S/C40H43NO4/c1-5-39(42)44-25-7-9-33-27-34(10-8-26-45-40(43)6-2)29-35(28-33)16-15-32-17-23-38(24-18-32)41(36-19-11-30(3)12-20-36)37-21-13-31(4)14-22-37/h5-6,11-14,17-24,27-29H,1-2,7-10,15-16,25-26H2,3-4H3 |
| InChIKey | FPMNFHZDZJGMKJ-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|