C34H39NO5 — CID 58883094
2-[4-[4-(6-methoxyhexyl)-N-[4-(prop-2-enoyloxymethyl)phenyl]anilino]phenyl]ethyl prop-2-enoate (PubChem CID 58883094) has the molecular formula C34H39NO5 and a molecular weight of 541.69 g/mol. Its IUPAC name is 2-[4-[4-(6-methoxyhexyl)-N-[4-(prop-2-enoyloxymethyl)phenyl]anilino]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-[4-(6-methoxyhexyl)-N-[4-(prop-2-enoyloxymethyl)phenyl]anilino]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 58883094 |
| Molecular Formula | C34H39NO5 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 2-[4-[4-(6-methoxyhexyl)-N-[4-(prop-2-enoyloxymethyl)phenyl]anilino]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(N(c2ccc(CCCCCCOC)cc2)c2ccc(COC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C34H39NO5/c1-4-33(36)39-25-23-28-13-19-31(20-14-28)35(32-21-15-29(16-22-32)26-40-34(37)5-2)30-17-11-27(12-18-30)10-8-6-7-9-24-38-3/h4-5,11-22H,1-2,6-10,23-26H2,3H3 |
| InChIKey | FOKCPHNPCLTMRP-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|