C34H33NO4 — CID 170682277
3-[4-[N-naphthalen-2-yl-4-(3-prop-2-enoyloxypropyl)anilino]phenyl]propyl prop-2-enoate (PubChem CID 170682277) has the molecular formula C34H33NO4 and a molecular weight of 519.64 g/mol. Its IUPAC name is 3-[4-[N-naphthalen-2-yl-4-(3-prop-2-enoyloxypropyl)anilino]phenyl]propyl prop-2-enoate.
| Compound Name | 3-[4-[N-naphthalen-2-yl-4-(3-prop-2-enoyloxypropyl)anilino]phenyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 170682277 |
| Molecular Formula | C34H33NO4 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 3-[4-[N-naphthalen-2-yl-4-(3-prop-2-enoyloxypropyl)anilino]phenyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1ccc(N(c2ccc(CCCOC(=O)C=C)cc2)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C34H33NO4/c1-3-33(36)38-23-7-9-26-13-18-30(19-14-26)35(32-22-17-28-11-5-6-12-29(28)25-32)31-20-15-27(16-21-31)10-8-24-39-34(37)4-2/h3-6,11-22,25H,1-2,7-10,23-24H2 |
| InChIKey | CVBUFIJGPMENFC-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|