C31H29NO2 — CID 170007474
2-[4-(N-(3,4-dimethylphenyl)-4-phenylanilino)phenyl]ethyl prop-2-enoate (PubChem CID 170007474) has the molecular formula C31H29NO2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 2-[4-(N-(3,4-dimethylphenyl)-4-phenylanilino)phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-(N-(3,4-dimethylphenyl)-4-phenylanilino)phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 170007474 |
| Molecular Formula | C31H29NO2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-[4-(N-(3,4-dimethylphenyl)-4-phenylanilino)phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C31H29NO2/c1-4-31(33)34-21-20-25-11-16-28(17-12-25)32(30-15-10-23(2)24(3)22-30)29-18-13-27(14-19-29)26-8-6-5-7-9-26/h4-19,22H,1,20-21H2,2-3H3 |
| InChIKey | AQTSXNYOODKCAZ-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|