C37H37NO3 — CID 170284469
3-[4-[4-(3-buta-1,3-dien-2-yloxypropyl)-N-(4-phenylphenyl)anilino]phenyl]propyl prop-2-enoate (PubChem CID 170284469) has the molecular formula C37H37NO3 and a molecular weight of 543.71 g/mol. Its IUPAC name is 3-[4-[4-(3-buta-1,3-dien-2-yloxypropyl)-N-(4-phenylphenyl)anilino]phenyl]propyl prop-2-enoate.
| Compound Name | 3-[4-[4-(3-buta-1,3-dien-2-yloxypropyl)-N-(4-phenylphenyl)anilino]phenyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 170284469 |
| Molecular Formula | C37H37NO3 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 3-[4-[4-(3-buta-1,3-dien-2-yloxypropyl)-N-(4-phenylphenyl)anilino]phenyl]propyl prop-2-enoate |
| SMILES | C=CC(=C)OCCCc1ccc(N(c2ccc(CCCOC(=O)C=C)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H37NO3/c1-4-29(3)40-27-9-11-30-15-21-34(22-16-30)38(36-25-19-33(20-26-36)32-13-7-6-8-14-32)35-23-17-31(18-24-35)12-10-28-41-37(39)5-2/h4-8,13-26H,1-3,9-12,27-28H2 |
| InChIKey | JAGYYMKRKNCIHV-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|