C32H31NO2 — CID 58571420
3-[4-(N-(3,4-dimethylphenyl)-4-phenylanilino)phenyl]propyl prop-2-enoate (PubChem CID 58571420) has the molecular formula C32H31NO2 and a molecular weight of 461.61 g/mol. Its IUPAC name is 3-[4-(N-(3,4-dimethylphenyl)-4-phenylanilino)phenyl]propyl prop-2-enoate.
| Compound Name | 3-[4-(N-(3,4-dimethylphenyl)-4-phenylanilino)phenyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 58571420 |
| Molecular Formula | C32H31NO2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 3-[4-(N-(3,4-dimethylphenyl)-4-phenylanilino)phenyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C32H31NO2/c1-4-32(34)35-22-8-9-26-13-18-29(19-14-26)33(31-17-12-24(2)25(3)23-31)30-20-15-28(16-21-30)27-10-6-5-7-11-27/h4-7,10-21,23H,1,8-9,22H2,2-3H3 |
| InChIKey | XQEATQJGGPJOLB-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|