C38H37NO — CID 89419387
N-[4-[3-[(4-ethenylphenyl)methoxy]propyl]phenyl]-3,4-dimethyl-N-(4-phenylphenyl)aniline (PubChem CID 89419387) has the molecular formula C38H37NO and a molecular weight of 523.72 g/mol. Its IUPAC name is N-[4-[3-[(4-ethenylphenyl)methoxy]propyl]phenyl]-3,4-dimethyl-N-(4-phenylphenyl)aniline.
| Compound Name | N-[4-[3-[(4-ethenylphenyl)methoxy]propyl]phenyl]-3,4-dimethyl-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 89419387 |
| Molecular Formula | C38H37NO |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | N-[4-[3-[(4-ethenylphenyl)methoxy]propyl]phenyl]-3,4-dimethyl-N-(4-phenylphenyl)aniline |
| SMILES | C=Cc1ccc(COCCCc2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(C)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C38H37NO/c1-4-31-13-15-33(16-14-31)28-40-26-8-9-32-17-22-36(23-18-32)39(38-21-12-29(2)30(3)27-38)37-24-19-35(20-25-37)34-10-6-5-7-11-34/h4-7,10-25,27H,1,8-9,26,28H2,2-3H3 |
| InChIKey | UXVVPTAEFOTNAQ-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|