C34H33F6NO4 — CID 123450384
3-[4-[N-(3,4-dimethylphenyl)-4-[3-(4,4,4-trifluorobut-2-enoyloxy)propyl]anilino]phenyl]propyl 4,4,4-trifluorobut-2-enoate (PubChem CID 123450384) has the molecular formula C34H33F6NO4 and a molecular weight of 633.63 g/mol. Its IUPAC name is 3-[4-[N-(3,4-dimethylphenyl)-4-[3-(4,4,4-trifluorobut-2-enoyloxy)propyl]anilino]phenyl]propyl 4,4,4-trifluorobut-2-enoate.
| Compound Name | 3-[4-[N-(3,4-dimethylphenyl)-4-[3-(4,4,4-trifluorobut-2-enoyloxy)propyl]anilino]phenyl]propyl 4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 123450384 |
| Molecular Formula | C34H33F6NO4 |
| Molecular Weight | 633.63 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | 3-[4-[N-(3,4-dimethylphenyl)-4-[3-(4,4,4-trifluorobut-2-enoyloxy)propyl]anilino]phenyl]propyl 4,4,4-trifluorobut-2-enoate |
| SMILES | Cc1ccc(N(c2ccc(CCCOC(=O)C=CC(F)(F)F)cc2)c2ccc(CCCOC(=O)C=CC(F)(F)F)cc2)cc1C |
| InChI | InChI=1S/C34H33F6NO4/c1-24-7-12-30(23-25(24)2)41(28-13-8-26(9-14-28)5-3-21-44-31(42)17-19-33(35,36)37)29-15-10-27(11-16-29)6-4-22-45-32(43)18-20-34(38,39)40/h7-20,23H,3-6,21-22H2,1-2H3 |
| InChIKey | GIIFSEIPJXZMKF-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.63 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|