C52H52N2O5 — CID 90168269
3-[4-(N-[4-[4-(N-[4-[3-[(E)-but-2-enoyl]oxypropyl]phenyl]-4-methylanilino)phenoxy]phenyl]-4-methylanilino)phenyl]propyl (E)-but-2-enoate (PubChem CID 90168269) has the molecular formula C52H52N2O5 and a molecular weight of 785.00 g/mol. Its IUPAC name is 3-[4-(N-[4-[4-(N-[4-[3-[(E)-but-2-enoyl]oxypropyl]phenyl]-4-methylanilino)phenoxy]phenyl]-4-methylanilino)phenyl]propyl (E)-but-2-enoate.
| Compound Name | 3-[4-(N-[4-[4-(N-[4-[3-[(E)-but-2-enoyl]oxypropyl]phenyl]-4-methylanilino)phenoxy]phenyl]-4-methylanilino)phenyl]propyl (E)-but-2-enoate |
|---|---|
| PubChem CID | 90168269 |
| Molecular Formula | C52H52N2O5 |
| Molecular Weight | 785.00 g/mol |
| Exact Mass | 784.39 |
| IUPAC Name | 3-[4-(N-[4-[4-(N-[4-[3-[(E)-but-2-enoyl]oxypropyl]phenyl]-4-methylanilino)phenoxy]phenyl]-4-methylanilino)phenyl]propyl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCCCc1ccc(N(c2ccc(C)cc2)c2ccc(Oc3ccc(N(c4ccc(C)cc4)c4ccc(CCCOC(=O)/C=C/C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C52H52N2O5/c1-5-9-51(55)57-37-7-11-41-17-25-45(26-18-41)53(43-21-13-39(3)14-22-43)47-29-33-49(34-30-47)59-50-35-31-48(32-36-50)54(44-23-15-40(4)16-24-44)46-27-19-42(20-28-46)12-8-38-58-52(56)10-6-2/h5-6,9-10,13-36H,7-8,11-12,37-38H2,1-4H3/b9-5+,10-6+ |
| InChIKey | AAARDIXGXUCHET-NXZHAISVSA-N |
| XLogP | 13.14 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.00 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|